C24H25F3N4O4S2 — CID 44525219
N-[3-[[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]methylamino]propyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 44525219) has the molecular formula C24H25F3N4O4S2 and a molecular weight of 554.62 g/mol. Its IUPAC name is N-[3-[[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]methylamino]propyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]methylamino]propyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44525219 |
| Molecular Formula | C24H25F3N4O4S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[3-[[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]methylamino]propyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NCCCNCc1cccc(-c2csc(-c3nc4ccccc4[nH]3)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O2S2.C2HF3O2/c1-30(27,28)24-11-5-10-23-14-16-6-4-7-17(12-16)18-13-21(29-15-18)22-25-19-8-2-3-9-20(19)26-22;3-2(4,5)1(6)7/h2-4,6-9,12-13,15,23-24H,5,10-11,14H2,1H3,(H,25,26);(H,6,7) |
| InChIKey | BRIQUJNCJOTPMW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|