About (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone
(6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone (PubChem CID 44525324) has the molecular formula C21H18ClN3OS2
and a molecular weight of 427.98 g/mol. Its IUPAC name is (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| PubChem CID | 44525324 |
| Molecular Formula | C21H18ClN3OS2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc2c(s1)-c1cccc(Cl)c1SC2)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C21H18ClN3OS2/c22-17-3-1-2-16-19-14(13-27-20(16)17)12-18(28-19)21(26)25-10-8-24(9-11-25)15-4-6-23-7-5-15/h1-7,12H,8-11,13H2 |
| InChIKey | YKSUODXGCQLTNR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
The IUPAC name of (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone (CID 44525324) is (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
The canonical SMILES for (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone is O=C(c1cc2c(s1)-c1cccc(Cl)c1SC2)N1CCN(c2ccncc2)CC1.
What is the InChIKey of (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
The InChIKey is YKSUODXGCQLTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3OS2/c22-17-3-1-2-16-19-14(13-27-20(16)17)12-18(28-19)21(26)25-10-8-24(9-11-25)15-4-6-23-7-5-15/h1-7,12H,8-11,13H2.
What are the key properties of (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
(6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone has a molecular weight of 427.98 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4H-thieno[3,2-c]thiochromen-2-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 44525324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).