C26H22N4O2S — CID 44525423
1-(4-methoxyphenyl)-3-[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]urea (PubChem CID 44525423) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 44525423 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[4-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(-c3ccc(-c4nc5c(C)cccc5[nH]4)s3)cc2)cc1 |
| InChI | InChI=1S/C26H22N4O2S/c1-16-4-3-5-21-24(16)30-25(29-21)23-15-14-22(33-23)17-6-8-18(9-7-17)27-26(31)28-19-10-12-20(32-2)13-11-19/h3-15H,1-2H3,(H,29,30)(H2,27,28,31) |
| InChIKey | JMTQJXPGMPWYEY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |