C30H29F6N3O2 — CID 44525573
N-[4-[4-[3-cyano-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]butoxy]phenyl]butanamide (PubChem CID 44525573) has the molecular formula C30H29F6N3O2 and a molecular weight of 577.57 g/mol. Its IUPAC name is N-[4-[4-[3-cyano-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]butoxy]phenyl]butanamide.
| Compound Name | N-[4-[4-[3-cyano-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]butoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 44525573 |
| Molecular Formula | C30H29F6N3O2 |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | N-[4-[4-[3-cyano-4-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]butoxy]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(OCCCCN(Cc2ccccc2C(F)(F)F)c2ccc(C(F)(F)F)c(C#N)c2)cc1 |
| InChI | InChI=1S/C30H29F6N3O2/c1-2-7-28(40)38-23-10-13-25(14-11-23)41-17-6-5-16-39(20-21-8-3-4-9-26(21)29(31,32)33)24-12-15-27(30(34,35)36)22(18-24)19-37/h3-4,8-15,18H,2,5-7,16-17,20H2,1H3,(H,38,40) |
| InChIKey | UGNDFSWWRHOBLB-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|