C19H30N6 — CID 44525617
2-N-tert-butyl-4-N-[(2,6-dimethylphenyl)methyl]-6-N-propyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 44525617) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-N-tert-butyl-4-N-[(2,6-dimethylphenyl)methyl]-6-N-propyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-tert-butyl-4-N-[(2,6-dimethylphenyl)methyl]-6-N-propyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 44525617 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 2-N-tert-butyl-4-N-[(2,6-dimethylphenyl)methyl]-6-N-propyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(NCc2c(C)cccc2C)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C19H30N6/c1-7-11-20-16-22-17(24-18(23-16)25-19(4,5)6)21-12-15-13(2)9-8-10-14(15)3/h8-10H,7,11-12H2,1-6H3,(H3,20,21,22,23,24,25) |
| InChIKey | XFXXABQNZQAZEM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |