C19H14F3N5O — CID 44525752
3-[[2-(3-methoxyanilino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 44525752) has the molecular formula C19H14F3N5O and a molecular weight of 385.35 g/mol. Its IUPAC name is 3-[[2-(3-methoxyanilino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[2-(3-methoxyanilino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 44525752 |
| Molecular Formula | C19H14F3N5O |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-[[2-(3-methoxyanilino)-6-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | COc1cccc(Nc2nc(Nc3cccc(C#N)c3)cc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C19H14F3N5O/c1-28-15-7-3-6-14(9-15)25-18-26-16(19(20,21)22)10-17(27-18)24-13-5-2-4-12(8-13)11-23/h2-10H,1H3,(H2,24,25,26,27) |
| InChIKey | UCBZKCAHMABGMZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |