C24H25F3N4O3 — CID 44525777
1-[2-(benzylamino)ethyl]-2-(furan-2-yl)-N,N-dimethylbenzimidazol-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 44525777) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is 1-[2-(benzylamino)ethyl]-2-(furan-2-yl)-N,N-dimethylbenzimidazol-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-(benzylamino)ethyl]-2-(furan-2-yl)-N,N-dimethylbenzimidazol-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44525777 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1-[2-(benzylamino)ethyl]-2-(furan-2-yl)-N,N-dimethylbenzimidazol-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1cccc2c1nc(-c1ccco1)n2CCNCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O.C2HF3O2/c1-25(2)18-10-6-11-19-21(18)24-22(20-12-7-15-27-20)26(19)14-13-23-16-17-8-4-3-5-9-17;3-2(4,5)1(6)7/h3-12,15,23H,13-14,16H2,1-2H3;(H,6,7) |
| InChIKey | BDAGREWQEPLDNZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|