C28H27F6N3O — CID 44525796
(E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(8-cyano-1,3,4,5-tetrahydro-2-benzazepin-2-yl)cyclohexyl]prop-2-enamide (PubChem CID 44525796) has the molecular formula C28H27F6N3O and a molecular weight of 535.53 g/mol. Its IUPAC name is (E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(8-cyano-1,3,4,5-tetrahydro-2-benzazepin-2-yl)cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(8-cyano-1,3,4,5-tetrahydro-2-benzazepin-2-yl)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 44525796 |
| Molecular Formula | C28H27F6N3O |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | (E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(8-cyano-1,3,4,5-tetrahydro-2-benzazepin-2-yl)cyclohexyl]prop-2-enamide |
| SMILES | N#Cc1ccc2c(c1)CN(C1CCC(NC(=O)/C=C/c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC1)CCC2 |
| InChI | InChI=1S/C28H27F6N3O/c29-27(30,31)22-13-18(14-23(15-22)28(32,33)34)4-10-26(38)36-24-6-8-25(9-7-24)37-11-1-2-20-5-3-19(16-35)12-21(20)17-37/h3-5,10,12-15,24-25H,1-2,6-9,11,17H2,(H,36,38)/b10-4+ |
| InChIKey | SDLOVUWTWAVTPL-ONNFQVAWSA-N |
| XLogP | 6.48 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|