C26H23F5N2O4 — CID 44526683
3-[5-(2,4-difluorophenyl)furan-2-yl]-N-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-7-yl)prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 44526683) has the molecular formula C26H23F5N2O4 and a molecular weight of 522.47 g/mol. Its IUPAC name is 3-[5-(2,4-difluorophenyl)furan-2-yl]-N-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-7-yl)prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[5-(2,4-difluorophenyl)furan-2-yl]-N-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-7-yl)prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44526683 |
| Molecular Formula | C26H23F5N2O4 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 3-[5-(2,4-difluorophenyl)furan-2-yl]-N-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-7-yl)prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCCc2cc(NC(=O)C=Cc3ccc(-c4ccc(F)cc4F)o3)ccc2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H22F2N2O2.C2HF3O2/c1-28-12-2-3-16-13-19(6-4-17(16)15-28)27-24(29)11-8-20-7-10-23(30-20)21-9-5-18(25)14-22(21)26;3-2(4,5)1(6)7/h4-11,13-14H,2-3,12,15H2,1H3,(H,27,29);(H,6,7) |
| InChIKey | FSILVIXSNPPYNP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|