C30H37N3O3S — CID 44526707
4-phenoxy-N-[3-[2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]phenyl]benzenesulfonamide (PubChem CID 44526707) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is 4-phenoxy-N-[3-[2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-phenoxy-N-[3-[2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44526707 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-phenoxy-N-[3-[2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CCN2CCC(N3CCCCC3)CC2)c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H37N3O3S/c34-37(35,30-14-12-29(13-15-30)36-28-10-3-1-4-11-28)31-26-9-7-8-25(24-26)16-21-32-22-17-27(18-23-32)33-19-5-2-6-20-33/h1,3-4,7-15,24,27,31H,2,5-6,16-23H2 |
| InChIKey | VOUSMHMYYCKHSK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |