C22H19ClN4O — CID 44526849
5-(2-chloro-3-pyridinyl)-N-(3,3-diphenylpropyl)-1,2,4-oxadiazol-3-amine (PubChem CID 44526849) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is 5-(2-chloro-3-pyridinyl)-N-(3,3-diphenylpropyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-chloro-3-pyridinyl)-N-(3,3-diphenylpropyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 44526849 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-(2-chloro-3-pyridinyl)-N-(3,3-diphenylpropyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Clc1ncccc1-c1nc(NCCC(c2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C22H19ClN4O/c23-20-19(12-7-14-24-20)21-26-22(27-28-21)25-15-13-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-12,14,18H,13,15H2,(H,25,27) |
| InChIKey | ZJAMEDTZBBUACB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|