About 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide
2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide (PubChem CID 44526922) has the molecular formula C22H21N5O4S2
and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide |
| PubChem CID | 44526922 |
| Molecular Formula | C22H21N5O4S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(-c2ccc3nccc(-c4cccc(S(N)(=O)=O)c4)c3c2)cnc1N |
| InChI | InChI=1S/C22H21N5O4S2/c1-27(2)33(30,31)21-12-16(13-26-22(21)23)14-6-7-20-19(11-14)18(8-9-25-20)15-4-3-5-17(10-15)32(24,28)29/h3-13H,1-2H3,(H2,23,26)(H2,24,28,29) |
| InChIKey | GUTGEMORYRGQDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide?
The IUPAC name of 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide (CID 44526922) is 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide.
What is the SMILES notation for 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide?
The canonical SMILES for 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide is CN(C)S(=O)(=O)c1cc(-c2ccc3nccc(-c4cccc(S(N)(=O)=O)c4)c3c2)cnc1N.
What is the InChIKey of 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide?
The InChIKey is GUTGEMORYRGQDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5O4S2/c1-27(2)33(30,31)21-12-16(13-26-22(21)23)14-6-7-20-19(11-14)18(8-9-25-20)15-4-3-5-17(10-15)32(24,28)29/h3-13H,1-2H3,(H2,23,26)(H2,24,28,29).
What are the key properties of 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide?
2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide has a molecular weight of 483.58 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-dimethyl-5-[4-(3-sulfamoylphenyl)quinolin-6-yl]pyridine-3-sulfonamide is sourced from PubChem (CID 44526922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).