C16H10Cl4N4 — CID 44527001
2-N,4-N-bis(3,5-dichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 44527001) has the molecular formula C16H10Cl4N4 and a molecular weight of 400.10 g/mol. Its IUPAC name is 2-N,4-N-bis(3,5-dichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3,5-dichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44527001 |
| Molecular Formula | C16H10Cl4N4 |
| Molecular Weight | 400.10 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 2-N,4-N-bis(3,5-dichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | Clc1cc(Cl)cc(Nc2ccnc(Nc3cc(Cl)cc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C16H10Cl4N4/c17-9-3-10(18)6-13(5-9)22-15-1-2-21-16(24-15)23-14-7-11(19)4-12(20)8-14/h1-8H,(H2,21,22,23,24) |
| InChIKey | JBBCIBBWVVQCOH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.10 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |