C24H30ClN5O4 — CID 44527051
4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)-1-[[(6-methoxy-1,5-naphthyridin-4-yl)amino]methyl]cyclohexan-1-ol;hydrochloride (PubChem CID 44527051) has the molecular formula C24H30ClN5O4 and a molecular weight of 487.99 g/mol. Its IUPAC name is 4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)-1-[[(6-methoxy-1,5-naphthyridin-4-yl)amino]methyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)-1-[[(6-methoxy-1,5-naphthyridin-4-yl)amino]methyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 44527051 |
| Molecular Formula | C24H30ClN5O4 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 4-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)-1-[[(6-methoxy-1,5-naphthyridin-4-yl)amino]methyl]cyclohexan-1-ol;hydrochloride |
| SMILES | COc1ccc2nccc(NCC3(O)CCC(NCc4cc5c(cn4)OCCO5)CC3)c2n1.Cl |
| InChI | InChI=1S/C24H29N5O4.ClH/c1-31-22-3-2-18-23(29-22)19(6-9-25-18)28-15-24(30)7-4-16(5-8-24)26-13-17-12-20-21(14-27-17)33-11-10-32-20;/h2-3,6,9,12,14,16,26,30H,4-5,7-8,10-11,13,15H2,1H3,(H,25,28);1H |
| InChIKey | LWWYZHXTTHDQFK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |