C27H29ClF3N3O3S — CID 44527080
5-(2-chlorophenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44527080) has the molecular formula C27H29ClF3N3O3S and a molecular weight of 568.06 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(2-chlorophenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527080 |
| Molecular Formula | C27H29ClF3N3O3S |
| Molecular Weight | 568.06 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1ccc(CN2CCC(NC(=O)c3ccc(-c4ccccc4Cl)s3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28ClN3OS.C2HF3O2/c1-28(2)20-9-7-18(8-10-20)17-29-15-13-19(14-16-29)27-25(30)24-12-11-23(31-24)21-5-3-4-6-22(21)26;3-2(4,5)1(6)7/h3-12,19H,13-17H2,1-2H3,(H,27,30);(H,6,7) |
| InChIKey | BQYNKHCETQEUEU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.06 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|