C26H35N5O2S — CID 44527162
N-[2-[3-[[5-[3-(dimethylamino)phenyl]-2-pyridinyl]amino]phenyl]sulfonylethyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 44527162) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is N-[2-[3-[[5-[3-(dimethylamino)phenyl]-2-pyridinyl]amino]phenyl]sulfonylethyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[3-[[5-[3-(dimethylamino)phenyl]-2-pyridinyl]amino]phenyl]sulfonylethyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 44527162 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N-[2-[3-[[5-[3-(dimethylamino)phenyl]-2-pyridinyl]amino]phenyl]sulfonylethyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCCS(=O)(=O)c1cccc(Nc2ccc(-c3cccc(N(C)C)c3)cn2)c1 |
| InChI | InChI=1S/C26H35N5O2S/c1-30(2)16-7-14-27-15-17-34(32,33)25-11-6-9-23(19-25)29-26-13-12-22(20-28-26)21-8-5-10-24(18-21)31(3)4/h5-6,8-13,18-20,27H,7,14-17H2,1-4H3,(H,28,29) |
| InChIKey | TVVUBDHFBGIMEP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|