C35H40F3N3O3 — CID 44527174
N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide (PubChem CID 44527174) has the molecular formula C35H40F3N3O3 and a molecular weight of 607.72 g/mol. Its IUPAC name is N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide.
| Compound Name | N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 44527174 |
| Molecular Formula | C35H40F3N3O3 |
| Molecular Weight | 607.72 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | N-[4-[4-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
| SMILES | COc1c(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(NC(=O)C(F)(F)F)cc4)cc3)CC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C35H40F3N3O3/c1-44-32-30-7-3-2-6-26(30)14-17-31(32)27-18-22-41(23-19-27)21-5-4-20-39-33(42)28-10-8-24(9-11-28)25-12-15-29(16-13-25)40-34(43)35(36,37)38/h8-17,27H,2-7,18-23H2,1H3,(H,39,42)(H,40,43) |
| InChIKey | GSALJULVMQXISE-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|