C28H31F4N3O3S — CID 44527338
N-[1-[[4-(dimethylamino)phenyl]methyl]azepan-3-yl]-4-(2-fluorophenyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44527338) has the molecular formula C28H31F4N3O3S and a molecular weight of 565.63 g/mol. Its IUPAC name is N-[1-[[4-(dimethylamino)phenyl]methyl]azepan-3-yl]-4-(2-fluorophenyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-[[4-(dimethylamino)phenyl]methyl]azepan-3-yl]-4-(2-fluorophenyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527338 |
| Molecular Formula | C28H31F4N3O3S |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | N-[1-[[4-(dimethylamino)phenyl]methyl]azepan-3-yl]-4-(2-fluorophenyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1ccc(CN2CCCCC(NC(=O)c3cc(-c4ccccc4F)cs3)C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H30FN3OS.C2HF3O2/c1-29(2)22-12-10-19(11-13-22)16-30-14-6-5-7-21(17-30)28-26(31)25-15-20(18-32-25)23-8-3-4-9-24(23)27;3-2(4,5)1(6)7/h3-4,8-13,15,18,21H,5-7,14,16-17H2,1-2H3,(H,28,31);(H,6,7) |
| InChIKey | BXWGYJPZFQXPAZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|