C23H19FN2O3 — CID 44527409
4-(4-fluorophenyl)-7-(3-methoxyphenyl)isoquinolin-1-amine;formic acid (PubChem CID 44527409) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-7-(3-methoxyphenyl)isoquinolin-1-amine;formic acid.
| Compound Name | 4-(4-fluorophenyl)-7-(3-methoxyphenyl)isoquinolin-1-amine;formic acid |
|---|---|
| PubChem CID | 44527409 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-(4-fluorophenyl)-7-(3-methoxyphenyl)isoquinolin-1-amine;formic acid |
| SMILES | COc1cccc(-c2ccc3c(-c4ccc(F)cc4)cnc(N)c3c2)c1.O=CO |
| InChI | InChI=1S/C22H17FN2O.CH2O2/c1-26-18-4-2-3-15(11-18)16-7-10-19-20(12-16)22(24)25-13-21(19)14-5-8-17(23)9-6-14;2-1-3/h2-13H,1H3,(H2,24,25);1H,(H,2,3) |
| InChIKey | AMKHDQDJMJMSBM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|