C22H21F3N2O2 — CID 44527461
benzyl 1-(3,3,3-trifluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 44527461) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is benzyl 1-(3,3,3-trifluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl 1-(3,3,3-trifluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 44527461 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | benzyl 1-(3,3,3-trifluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2c([nH]c3ccccc23)C1CCC(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O2/c23-22(24,25)12-10-19-20-17(16-8-4-5-9-18(16)26-20)11-13-27(19)21(28)29-14-15-6-2-1-3-7-15/h1-9,19,26H,10-14H2 |
| InChIKey | WWIGVVFFAQYPKP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|