C25H30N6O4S — CID 44527655
6-[[[(3R,4R)-1-[2-(3,6-dimethoxy-1,5-naphthyridin-4-yl)ethyl]-3-hydroxypiperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 44527655) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is 6-[[[(3R,4R)-1-[2-(3,6-dimethoxy-1,5-naphthyridin-4-yl)ethyl]-3-hydroxypiperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[[(3R,4R)-1-[2-(3,6-dimethoxy-1,5-naphthyridin-4-yl)ethyl]-3-hydroxypiperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 44527655 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 6-[[[(3R,4R)-1-[2-(3,6-dimethoxy-1,5-naphthyridin-4-yl)ethyl]-3-hydroxypiperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | COc1ccc2ncc(OC)c(CCN3CC[C@@H](NCc4ccc5c(n4)NC(=O)CS5)[C@H](O)C3)c2n1 |
| InChI | InChI=1S/C25H30N6O4S/c1-34-20-12-27-18-4-6-23(35-2)30-24(18)16(20)7-9-31-10-8-17(19(32)13-31)26-11-15-3-5-21-25(28-15)29-22(33)14-36-21/h3-6,12,17,19,26,32H,7-11,13-14H2,1-2H3,(H,28,29,33)/t17-,19-/m1/s1 |
| InChIKey | ISPYXUPXIZNIIN-IEBWSBKVSA-N |
| XLogP | 1.85 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |