C30H30F3N5O4 — CID 44527746
(2S)-2-[(2-anilino-6-methylpyrimidin-4-yl)amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 44527746) has the molecular formula C30H30F3N5O4 and a molecular weight of 581.60 g/mol. Its IUPAC name is (2S)-2-[(2-anilino-6-methylpyrimidin-4-yl)amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[(2-anilino-6-methylpyrimidin-4-yl)amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527746 |
| Molecular Formula | C30H30F3N5O4 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | (2S)-2-[(2-anilino-6-methylpyrimidin-4-yl)amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N[C@@H](Cc2ccccc2)C(=O)NCCOc2ccccc2)nc(Nc2ccccc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H29N5O2.C2HF3O2/c1-21-19-26(33-28(30-21)31-23-13-7-3-8-14-23)32-25(20-22-11-5-2-6-12-22)27(34)29-17-18-35-24-15-9-4-10-16-24;3-2(4,5)1(6)7/h2-16,19,25H,17-18,20H2,1H3,(H,29,34)(H2,30,31,32,33);(H,6,7)/t25-;/m0./s1 |
| InChIKey | MZZFKIDSJIKOGZ-UQIIZPHYSA-N |
| XLogP | 5.38 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|