C32H34F3N5O5 — CID 44527793
(2S)-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 44527793) has the molecular formula C32H34F3N5O5 and a molecular weight of 625.65 g/mol. Its IUPAC name is (2S)-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527793 |
| Molecular Formula | C32H34F3N5O5 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (2S)-2-[[6-methyl-2-(2-phenoxyethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N[C@@H](Cc2ccccc2)C(=O)NCCOc2ccccc2)nc(NCCOc2ccccc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H33N5O3.C2HF3O2/c1-23-21-28(35-30(33-23)32-18-20-38-26-15-9-4-10-16-26)34-27(22-24-11-5-2-6-12-24)29(36)31-17-19-37-25-13-7-3-8-14-25;3-2(4,5)1(6)7/h2-16,21,27H,17-20,22H2,1H3,(H,31,36)(H2,32,33,34,35);(H,6,7)/t27-;/m0./s1 |
| InChIKey | FNAUVCGCOJINIW-YCBFMBTMSA-N |
| XLogP | 5.13 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|