About (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone
(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone (PubChem CID 44527941) has the molecular formula C19H15BrN2O
and a molecular weight of 367.25 g/mol. Its IUPAC name is (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone.
Molecular Properties
| Compound Name | (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone |
| PubChem CID | 44527941 |
| Molecular Formula | C19H15BrN2O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2n1)N1CCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C19H15BrN2O/c20-15-8-10-18-14(12-15)5-3-11-22(18)19(23)17-9-7-13-4-1-2-6-16(13)21-17/h1-2,4,6-10,12H,3,5,11H2 |
| InChIKey | DSQUNUOOMRUINQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone?
The IUPAC name of (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone (CID 44527941) is (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone.
What is the SMILES notation for (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone?
The canonical SMILES for (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone is O=C(c1ccc2ccccc2n1)N1CCCc2cc(Br)ccc21.
What is the InChIKey of (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone?
The InChIKey is DSQUNUOOMRUINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN2O/c20-15-8-10-18-14(12-15)5-3-11-22(18)19(23)17-9-7-13-4-1-2-6-16(13)21-17/h1-2,4,6-10,12H,3,5,11H2.
What are the key properties of (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone?
(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone has a molecular weight of 367.25 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-quinolin-2-ylmethanone is sourced from PubChem (CID 44527941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).