C32H34F3N5O4 — CID 44527994
(2S)-2-[[6-methyl-2-(2-phenylethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 44527994) has the molecular formula C32H34F3N5O4 and a molecular weight of 609.65 g/mol. Its IUPAC name is (2S)-2-[[6-methyl-2-(2-phenylethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[6-methyl-2-(2-phenylethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527994 |
| Molecular Formula | C32H34F3N5O4 |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | (2S)-2-[[6-methyl-2-(2-phenylethylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N[C@@H](Cc2ccccc2)C(=O)NCCOc2ccccc2)nc(NCCc2ccccc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H33N5O2.C2HF3O2/c1-23-21-28(35-30(33-23)32-18-17-24-11-5-2-6-12-24)34-27(22-25-13-7-3-8-14-25)29(36)31-19-20-37-26-15-9-4-10-16-26;3-2(4,5)1(6)7/h2-16,21,27H,17-20,22H2,1H3,(H,31,36)(H2,32,33,34,35);(H,6,7)/t27-;/m0./s1 |
| InChIKey | LGUUPDRFIISULL-YCBFMBTMSA-N |
| XLogP | 5.29 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|