C31H38F3N5O4 — CID 44528122
(2S)-2-[[2-(cyclohexylmethylamino)-6-methylpyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 44528122) has the molecular formula C31H38F3N5O4 and a molecular weight of 601.67 g/mol. Its IUPAC name is (2S)-2-[[2-(cyclohexylmethylamino)-6-methylpyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[2-(cyclohexylmethylamino)-6-methylpyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44528122 |
| Molecular Formula | C31H38F3N5O4 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | (2S)-2-[[2-(cyclohexylmethylamino)-6-methylpyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(N[C@@H](Cc2ccccc2)C(=O)NCCOc2ccccc2)nc(NCC2CCCCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H37N5O2.C2HF3O2/c1-22-19-27(34-29(32-22)31-21-24-13-7-3-8-14-24)33-26(20-23-11-5-2-6-12-23)28(35)30-17-18-36-25-15-9-4-10-16-25;3-2(4,5)1(6)7/h2,4-6,9-12,15-16,19,24,26H,3,7-8,13-14,17-18,20-21H2,1H3,(H,30,35)(H2,31,32,33,34);(H,6,7)/t26-;/m0./s1 |
| InChIKey | FVSKSPQBLFFLHQ-SNYZSRNZSA-N |
| XLogP | 5.63 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|