C27H26F7N3O5S — CID 44528265
N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 44528265) has the molecular formula C27H26F7N3O5S and a molecular weight of 637.57 g/mol. Its IUPAC name is N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 44528265 |
| Molecular Formula | C27H26F7N3O5S |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 637.15 |
| IUPAC Name | N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3cccc(F)c3)CC2)cc1)c1cccs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24FN3OS.2C2HF3O2/c24-19-5-1-4-18(16-19)17-26-11-3-12-27(14-13-26)21-9-7-20(8-10-21)25-23(28)22-6-2-15-29-22;2*3-2(4,5)1(6)7/h1-2,4-10,15-16H,3,11-14,17H2,(H,25,28);2*(H,6,7) |
| InChIKey | QXARGAHKJWOVCU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|