C24H28N6S — CID 44528299
N-cyclopentyl-1-methyl-3-[3-[(2-thiophen-2-ylethylamino)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 44528299) has the molecular formula C24H28N6S and a molecular weight of 432.60 g/mol. Its IUPAC name is N-cyclopentyl-1-methyl-3-[3-[(2-thiophen-2-ylethylamino)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | N-cyclopentyl-1-methyl-3-[3-[(2-thiophen-2-ylethylamino)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 44528299 |
| Molecular Formula | C24H28N6S |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-cyclopentyl-1-methyl-3-[3-[(2-thiophen-2-ylethylamino)methyl]phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | Cn1nc(-c2cccc(CNCCc3cccs3)c2)c2cnc(NC3CCCC3)nc21 |
| InChI | InChI=1S/C24H28N6S/c1-30-23-21(16-26-24(28-23)27-19-8-2-3-9-19)22(29-30)18-7-4-6-17(14-18)15-25-12-11-20-10-5-13-31-20/h4-7,10,13-14,16,19,25H,2-3,8-9,11-12,15H2,1H3,(H,26,27,28) |
| InChIKey | HFALDDHQVUYYTR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|