C24H23F3N4O2 — CID 44528367
5-methyl-N-[1-[1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]-2,3-dihydroindol-5-yl]-1,2-oxazole-3-carboxamide (PubChem CID 44528367) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is 5-methyl-N-[1-[1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]-2,3-dihydroindol-5-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[1-[1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]-2,3-dihydroindol-5-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 44528367 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 5-methyl-N-[1-[1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-3-yl]-2,3-dihydroindol-5-yl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)CCN3C2CCN(Cc3cc(F)cc(F)c3F)C2)no1 |
| InChI | InChI=1S/C24H23F3N4O2/c1-14-8-21(29-33-14)24(32)28-18-2-3-22-15(10-18)4-7-31(22)19-5-6-30(13-19)12-16-9-17(25)11-20(26)23(16)27/h2-3,8-11,19H,4-7,12-13H2,1H3,(H,28,32) |
| InChIKey | QCAHBDSGJLPUBO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|