C22H17Cl3N4O3 — CID 44528390
2-[2-(2,4-dimethoxyphenyl)imidazo[4,5-b]pyridin-3-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 44528390) has the molecular formula C22H17Cl3N4O3 and a molecular weight of 491.76 g/mol. Its IUPAC name is 2-[2-(2,4-dimethoxyphenyl)imidazo[4,5-b]pyridin-3-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[2-(2,4-dimethoxyphenyl)imidazo[4,5-b]pyridin-3-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 44528390 |
| Molecular Formula | C22H17Cl3N4O3 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 2-[2-(2,4-dimethoxyphenyl)imidazo[4,5-b]pyridin-3-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | COc1ccc(-c2nc3cccnc3n2CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H17Cl3N4O3/c1-31-12-5-6-13(19(8-12)32-2)21-28-17-4-3-7-26-22(17)29(21)11-20(30)27-18-10-15(24)14(23)9-16(18)25/h3-10H,11H2,1-2H3,(H,27,30) |
| InChIKey | LGOBXVIXZGBMFU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|