About 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine
4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine (PubChem CID 44528477) has the molecular formula C17H11ClN4OS
and a molecular weight of 354.82 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine |
| PubChem CID | 44528477 |
| Molecular Formula | C17H11ClN4OS |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2cc(-c3csc(Nc4ccncc4)n3)on2)cc1 |
| InChI | InChI=1S/C17H11ClN4OS/c18-12-3-1-11(2-4-12)14-9-16(23-22-14)15-10-24-17(21-15)20-13-5-7-19-8-6-13/h1-10H,(H,19,20,21) |
| InChIKey | HPVMXYXQDIENFO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine?
The IUPAC name of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine (CID 44528477) is 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine?
The canonical SMILES for 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine is Clc1ccc(-c2cc(-c3csc(Nc4ccncc4)n3)on2)cc1.
What is the InChIKey of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine?
The InChIKey is HPVMXYXQDIENFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN4OS/c18-12-3-1-11(2-4-12)14-9-16(23-22-14)15-10-24-17(21-15)20-13-5-7-19-8-6-13/h1-10H,(H,19,20,21).
What are the key properties of 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine?
4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine has a molecular weight of 354.82 g/mol, XLogP of 5.26, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-N-pyridin-4-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 44528477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).