C24H27ClN2O — CID 44528503
1-[(1S)-6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one (PubChem CID 44528503) has the molecular formula C24H27ClN2O and a molecular weight of 394.95 g/mol. Its IUPAC name is 1-[(1S)-6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[(1S)-6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 44528503 |
| Molecular Formula | C24H27ClN2O |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[(1S)-6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one |
| SMILES | CC(C)C[C@H]1c2[nH]c3ccc(Cl)cc3c2CCN1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C24H27ClN2O/c1-16(2)14-22-24-19(20-15-18(25)9-10-21(20)26-24)12-13-27(22)23(28)11-8-17-6-4-3-5-7-17/h3-7,9-10,15-16,22,26H,8,11-14H2,1-2H3/t22-/m0/s1 |
| InChIKey | CCHQKJNOAPOWFJ-QFIPXVFZSA-N |
| XLogP | 5.93 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|