C33H36BrN3O2 — CID 44528588
N-[4-[4-(4-bromo-1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide (PubChem CID 44528588) has the molecular formula C33H36BrN3O2 and a molecular weight of 586.57 g/mol. Its IUPAC name is N-[4-[4-(4-bromo-1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide.
| Compound Name | N-[4-[4-(4-bromo-1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 44528588 |
| Molecular Formula | C33H36BrN3O2 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | N-[4-[4-(4-bromo-1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide |
| SMILES | N#Cc1ccc(-c2ccc(C(=O)NCCCCN3CCC(c4cc(Br)c5c(c4O)CCCC5)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H36BrN3O2/c34-31-21-30(32(38)29-6-2-1-5-28(29)31)26-15-19-37(20-16-26)18-4-3-17-36-33(39)27-13-11-25(12-14-27)24-9-7-23(22-35)8-10-24/h7-14,21,26,38H,1-6,15-20H2,(H,36,39) |
| InChIKey | WBKLREMGMLJEND-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|