About 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one
3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one (PubChem CID 44528606) has the molecular formula C22H23BrN2O2S
and a molecular weight of 459.41 g/mol. Its IUPAC name is 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one |
| PubChem CID | 44528606 |
| Molecular Formula | C22H23BrN2O2S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c(-c2ccc(OCCCCSc3ccncc3)cc2)c(=O)c1Br |
| InChI | InChI=1S/C22H23BrN2O2S/c1-15-20(22(26)21(23)16(2)25-15)17-5-7-18(8-6-17)27-13-3-4-14-28-19-9-11-24-12-10-19/h5-12H,3-4,13-14H2,1-2H3,(H,25,26) |
| InChIKey | QNCURNRSVDUFIQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one?
The IUPAC name of 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one (CID 44528606) is 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one.
What is the SMILES notation for 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one?
The canonical SMILES for 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one is Cc1[nH]c(C)c(-c2ccc(OCCCCSc3ccncc3)cc2)c(=O)c1Br.
What is the InChIKey of 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one?
The InChIKey is QNCURNRSVDUFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23BrN2O2S/c1-15-20(22(26)21(23)16(2)25-15)17-5-7-18(8-6-17)27-13-3-4-14-28-19-9-11-24-12-10-19/h5-12H,3-4,13-14H2,1-2H3,(H,25,26).
What are the key properties of 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one?
3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one has a molecular weight of 459.41 g/mol, XLogP of 5.77, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,6-dimethyl-5-[4-(4-pyridin-4-ylsulfanylbutoxy)phenyl]-1H-pyridin-4-one is sourced from PubChem (CID 44528606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).