About 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide
3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide (PubChem CID 44528665) has the molecular formula C12H10N4O2S2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide |
| PubChem CID | 44528665 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide |
| SMILES | Nc1ncnc2cc(-c3cccc(S(N)(=O)=O)c3)sc12 |
| InChI | InChI=1S/C12H10N4O2S2/c13-12-11-9(15-6-16-12)5-10(19-11)7-2-1-3-8(4-7)20(14,17)18/h1-6H,(H2,13,15,16)(H2,14,17,18) |
| InChIKey | MQMXDJVOZKMSNT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide?
The IUPAC name of 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide (CID 44528665) is 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide.
What is the SMILES notation for 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide?
The canonical SMILES for 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide is Nc1ncnc2cc(-c3cccc(S(N)(=O)=O)c3)sc12.
What is the InChIKey of 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide?
The InChIKey is MQMXDJVOZKMSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2S2/c13-12-11-9(15-6-16-12)5-10(19-11)7-2-1-3-8(4-7)20(14,17)18/h1-6H,(H2,13,15,16)(H2,14,17,18).
What are the key properties of 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide?
3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide has a molecular weight of 306.37 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminothieno[3,2-d]pyrimidin-6-yl)benzenesulfonamide is sourced from PubChem (CID 44528665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).