C29H38Cl2N2O2 — CID 44528704
1-[2-(3,4-dichlorophenyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]morpholin-4-yl]hexan-1-one (PubChem CID 44528704) has the molecular formula C29H38Cl2N2O2 and a molecular weight of 517.54 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]morpholin-4-yl]hexan-1-one.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]morpholin-4-yl]hexan-1-one |
|---|---|
| PubChem CID | 44528704 |
| Molecular Formula | C29H38Cl2N2O2 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]morpholin-4-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCOC(CCN2CCC(c3ccccc3)CC2)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C29H38Cl2N2O2/c1-2-3-5-10-28(34)33-19-20-35-29(22-33,25-11-12-26(30)27(31)21-25)15-18-32-16-13-24(14-17-32)23-8-6-4-7-9-23/h4,6-9,11-12,21,24H,2-3,5,10,13-20,22H2,1H3 |
| InChIKey | VIJJLJBURAKXBH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|