C29H27F6N3O2 — CID 44528868
N-[4-[3-[4-cyano-3-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]propoxy]phenyl]butanamide (PubChem CID 44528868) has the molecular formula C29H27F6N3O2 and a molecular weight of 563.54 g/mol. Its IUPAC name is N-[4-[3-[4-cyano-3-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]propoxy]phenyl]butanamide.
| Compound Name | N-[4-[3-[4-cyano-3-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]propoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 44528868 |
| Molecular Formula | C29H27F6N3O2 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | N-[4-[3-[4-cyano-3-(trifluoromethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]propoxy]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(OCCCN(Cc2ccccc2C(F)(F)F)c2ccc(C#N)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H27F6N3O2/c1-2-6-27(39)37-22-10-13-24(14-11-22)40-16-5-15-38(19-21-7-3-4-8-25(21)28(30,31)32)23-12-9-20(18-36)26(17-23)29(33,34)35/h3-4,7-14,17H,2,5-6,15-16,19H2,1H3,(H,37,39) |
| InChIKey | AEJQTSQJVQLXDL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|