C38H47N3O2 — CID 44528887
4-(4-cyanophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide (PubChem CID 44528887) has the molecular formula C38H47N3O2 and a molecular weight of 577.81 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-(4-cyanophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44528887 |
| Molecular Formula | C38H47N3O2 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.37 |
| IUPAC Name | 4-(4-cyanophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
| SMILES | COc1c(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C#N)cc4)cc3)CC2)ccc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C38H47N3O2/c1-37(2)20-21-38(3,4)34-33(37)17-16-32(35(34)43-5)30-18-24-41(25-19-30)23-7-6-22-40-36(42)31-14-12-29(13-15-31)28-10-8-27(26-39)9-11-28/h8-17,30H,6-7,18-25H2,1-5H3,(H,40,42) |
| InChIKey | SNJHNSBIWYFDRH-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|