C37H47ClN2O2 — CID 44528888
4-(4-chlorophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide (PubChem CID 44528888) has the molecular formula C37H47ClN2O2 and a molecular weight of 587.25 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44528888 |
| Molecular Formula | C37H47ClN2O2 |
| Molecular Weight | 587.25 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-[4-(1-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
| SMILES | COc1c(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(Cl)cc4)cc3)CC2)ccc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C37H47ClN2O2/c1-36(2)20-21-37(3,4)33-32(36)17-16-31(34(33)42-5)28-18-24-40(25-19-28)23-7-6-22-39-35(41)29-10-8-26(9-11-29)27-12-14-30(38)15-13-27/h8-17,28H,6-7,18-25H2,1-5H3,(H,39,41) |
| InChIKey | LBKLGHYZVXIEEU-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.25 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|