C21H20ClN5O2S — CID 44529015
4-[[5-(3-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-2-nitrobenzonitrile (PubChem CID 44529015) has the molecular formula C21H20ClN5O2S and a molecular weight of 441.94 g/mol. Its IUPAC name is 4-[[5-(3-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-2-nitrobenzonitrile.
| Compound Name | 4-[[5-(3-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 44529015 |
| Molecular Formula | C21H20ClN5O2S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-[[5-(3-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-2-nitrobenzonitrile |
| SMILES | CCCCCCn1c(Sc2ccc(C#N)c([N+](=O)[O-])c2)nnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20ClN5O2S/c1-2-3-4-5-11-26-20(15-7-6-8-17(22)12-15)24-25-21(26)30-18-10-9-16(14-23)19(13-18)27(28)29/h6-10,12-13H,2-5,11H2,1H3 |
| InChIKey | KEGIDAPVJFXGLQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|