C38H44N4O3 — CID 44529052
N-[4-[4-[1-(2-amino-2-oxoethoxy)-4-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide (PubChem CID 44529052) has the molecular formula C38H44N4O3 and a molecular weight of 604.80 g/mol. Its IUPAC name is N-[4-[4-[1-(2-amino-2-oxoethoxy)-4-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide.
| Compound Name | N-[4-[4-[1-(2-amino-2-oxoethoxy)-4-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 44529052 |
| Molecular Formula | C38H44N4O3 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | N-[4-[4-[1-(2-amino-2-oxoethoxy)-4-prop-2-enyl-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide |
| SMILES | C=CCc1cc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C#N)cc4)cc3)CC2)c(OCC(N)=O)c2c1CCCC2 |
| InChI | InChI=1S/C38H44N4O3/c1-2-7-32-24-35(37(45-26-36(40)43)34-9-4-3-8-33(32)34)30-18-22-42(23-19-30)21-6-5-20-41-38(44)31-16-14-29(15-17-31)28-12-10-27(25-39)11-13-28/h2,10-17,24,30H,1,3-9,18-23,26H2,(H2,40,43)(H,41,44) |
| InChIKey | DSNFATNYGKVXFK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|