C29H27F6N3O3 — CID 44529100
N-[4-[3-[4-cyano-N-[[2-(trifluoromethoxy)phenyl]methyl]-3-(trifluoromethyl)anilino]propoxy]phenyl]butanamide (PubChem CID 44529100) has the molecular formula C29H27F6N3O3 and a molecular weight of 579.54 g/mol. Its IUPAC name is N-[4-[3-[4-cyano-N-[[2-(trifluoromethoxy)phenyl]methyl]-3-(trifluoromethyl)anilino]propoxy]phenyl]butanamide.
| Compound Name | N-[4-[3-[4-cyano-N-[[2-(trifluoromethoxy)phenyl]methyl]-3-(trifluoromethyl)anilino]propoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 44529100 |
| Molecular Formula | C29H27F6N3O3 |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | N-[4-[3-[4-cyano-N-[[2-(trifluoromethoxy)phenyl]methyl]-3-(trifluoromethyl)anilino]propoxy]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(OCCCN(Cc2ccccc2OC(F)(F)F)c2ccc(C#N)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H27F6N3O3/c1-2-6-27(39)37-22-10-13-24(14-11-22)40-16-5-15-38(19-21-7-3-4-8-26(21)41-29(33,34)35)23-12-9-20(18-36)25(17-23)28(30,31)32/h3-4,7-14,17H,2,5-6,15-16,19H2,1H3,(H,37,39) |
| InChIKey | SBIGHCJDRJHIJV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|