C28H36Cl2N4O2 — CID 44529139
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,4-dimethylphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529139) has the molecular formula C28H36Cl2N4O2 and a molecular weight of 531.53 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,4-dimethylphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,4-dimethylphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529139 |
| Molecular Formula | C28H36Cl2N4O2 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,4-dimethylphenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)NC2CCN(CCCCCNC(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)cc1C |
| InChI | InChI=1S/C28H36Cl2N4O2/c1-20-6-9-24(18-21(20)2)33-28(36)32-23-12-16-34(17-13-23)15-5-3-4-14-31-27(35)11-8-22-7-10-25(29)26(30)19-22/h6-11,18-19,23H,3-5,12-17H2,1-2H3,(H,31,35)(H2,32,33,36)/b11-8+ |
| InChIKey | OHYUOHRHFXGOPD-DHZHZOJOSA-N |
| XLogP | 6.20 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|