C27H32Cl2N4O4 — CID 44529149
(E)-N-[5-[4-(1,3-benzodioxol-5-ylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 44529149) has the molecular formula C27H32Cl2N4O4 and a molecular weight of 547.48 g/mol. Its IUPAC name is (E)-N-[5-[4-(1,3-benzodioxol-5-ylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[4-(1,3-benzodioxol-5-ylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44529149 |
| Molecular Formula | C27H32Cl2N4O4 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (E)-N-[5-[4-(1,3-benzodioxol-5-ylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(NC(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C27H32Cl2N4O4/c28-22-7-4-19(16-23(22)29)5-9-26(34)30-12-2-1-3-13-33-14-10-20(11-15-33)31-27(35)32-21-6-8-24-25(17-21)37-18-36-24/h4-9,16-17,20H,1-3,10-15,18H2,(H,30,34)(H2,31,32,35)/b9-5+ |
| InChIKey | IVTSPVALHUFRQE-WEVVVXLNSA-N |
| XLogP | 5.31 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|