C27H32Cl2F2N4O3 — CID 44529153
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(difluoromethoxy)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529153) has the molecular formula C27H32Cl2F2N4O3 and a molecular weight of 569.48 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(difluoromethoxy)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(difluoromethoxy)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529153 |
| Molecular Formula | C27H32Cl2F2N4O3 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(difluoromethoxy)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(NC(=O)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H32Cl2F2N4O3/c28-23-10-4-19(18-24(23)29)5-11-25(36)32-14-2-1-3-15-35-16-12-21(13-17-35)34-27(37)33-20-6-8-22(9-7-20)38-26(30)31/h4-11,18,21,26H,1-3,12-17H2,(H,32,36)(H2,33,34,37)/b11-5+ |
| InChIKey | OZKQAQLGADMYDP-VZUCSPMQSA-N |
| XLogP | 6.18 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|