C27H31Cl2F3N4O2 — CID 44529154
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529154) has the molecular formula C27H31Cl2F3N4O2 and a molecular weight of 571.47 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529154 |
| Molecular Formula | C27H31Cl2F3N4O2 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(NC(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H31Cl2F3N4O2/c28-23-10-4-19(18-24(23)29)5-11-25(37)33-14-2-1-3-15-36-16-12-22(13-17-36)35-26(38)34-21-8-6-20(7-9-21)27(30,31)32/h4-11,18,22H,1-3,12-17H2,(H,33,37)(H2,34,35,38)/b11-5+ |
| InChIKey | OFVABPOBOTZHPP-VZUCSPMQSA-N |
| XLogP | 6.60 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|