C27H32Cl2F2N4O3 — CID 44529184
4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-[4-(difluoromethoxy)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 44529184) has the molecular formula C27H32Cl2F2N4O3 and a molecular weight of 569.48 g/mol. Its IUPAC name is 4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-[4-(difluoromethoxy)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-[4-(difluoromethoxy)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 44529184 |
| Molecular Formula | C27H32Cl2F2N4O3 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-[4-(difluoromethoxy)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCCN(C(=O)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H32Cl2F2N4O3/c28-23-11-5-20(19-24(23)29)6-12-25(36)32-13-2-1-3-14-34-15-4-16-35(18-17-34)27(37)33-21-7-9-22(10-8-21)38-26(30)31/h5-12,19,26H,1-4,13-18H2,(H,32,36)(H,33,37)/b12-6+ |
| InChIKey | QPNNRAMXKSXJRH-WUXMJOGZSA-N |
| XLogP | 6.13 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|