About 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride
3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride (PubChem CID 44529223) has the molecular formula C21H22BrClN2O2
and a molecular weight of 449.78 g/mol. Its IUPAC name is 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride |
| PubChem CID | 44529223 |
| Molecular Formula | C21H22BrClN2O2 |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride |
| SMILES | Cc1[nH]c(C)c(-c2ccc(OCCCc3ccccn3)cc2)c(=O)c1Br.Cl |
| InChI | InChI=1S/C21H21BrN2O2.ClH/c1-14-19(21(25)20(22)15(2)24-14)16-8-10-18(11-9-16)26-13-5-7-17-6-3-4-12-23-17;/h3-4,6,8-12H,5,7,13H2,1-2H3,(H,24,25);1H |
| InChIKey | HRGXMJDKZUMNFU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride?
The IUPAC name of 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride (CID 44529223) is 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride.
What is the SMILES notation for 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride?
The canonical SMILES for 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride is Cc1[nH]c(C)c(-c2ccc(OCCCc3ccccn3)cc2)c(=O)c1Br.Cl.
What is the InChIKey of 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride?
The InChIKey is HRGXMJDKZUMNFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21BrN2O2.ClH/c1-14-19(21(25)20(22)15(2)24-14)16-8-10-18(11-9-16)26-13-5-7-17-6-3-4-12-23-17;/h3-4,6,8-12H,5,7,13H2,1-2H3,(H,24,25);1H.
What are the key properties of 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride?
3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride has a molecular weight of 449.78 g/mol, XLogP of 5.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,6-dimethyl-5-[4-(3-pyridin-2-ylpropoxy)phenyl]-1H-pyridin-4-one;hydrochloride is sourced from PubChem (CID 44529223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).