C30H18F4N6O — CID 44529276
2,3,6-trifluoro-N-[3-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-2-yl]phenyl]benzamide (PubChem CID 44529276) has the molecular formula C30H18F4N6O and a molecular weight of 554.51 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-[3-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-2-yl]phenyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N-[3-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 44529276 |
| Molecular Formula | C30H18F4N6O |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2,3,6-trifluoro-N-[3-[3-[2-(3-fluoroanilino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nn3ccccc3c2-c2ccnc(Nc3cccc(F)c3)n2)c1)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C30H18F4N6O/c31-18-6-4-8-20(16-18)37-30-35-13-12-23(38-30)26-24-9-1-2-14-40(24)39-28(26)17-5-3-7-19(15-17)36-29(41)25-21(32)10-11-22(33)27(25)34/h1-16H,(H,36,41)(H,35,37,38) |
| InChIKey | CXYVXBADMYMZKB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|