About 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline
4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline (PubChem CID 44529290) has the molecular formula C27H27N3OS
and a molecular weight of 441.60 g/mol. Its IUPAC name is 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline.
Molecular Properties
| Compound Name | 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline |
| PubChem CID | 44529290 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline |
| SMILES | C[C@@H]1CN(c2ccnc3ccc(Sc4ccc(Oc5ccccc5)cc4)cc23)C[C@H](C)N1 |
| InChI | InChI=1S/C27H27N3OS/c1-19-17-30(18-20(2)29-19)27-14-15-28-26-13-12-24(16-25(26)27)32-23-10-8-22(9-11-23)31-21-6-4-3-5-7-21/h3-16,19-20,29H,17-18H2,1-2H3/t19-,20+ |
| InChIKey | PWOXOZQCXYPBMY-BGYRXZFFSA-N |
| XLogP | 6.36 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline?
The IUPAC name of 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline (CID 44529290) is 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline.
What is the SMILES notation for 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline?
The canonical SMILES for 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline is C[C@@H]1CN(c2ccnc3ccc(Sc4ccc(Oc5ccccc5)cc4)cc23)C[C@H](C)N1.
What is the InChIKey of 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline?
The InChIKey is PWOXOZQCXYPBMY-BGYRXZFFSA-N. The full InChI is InChI=1S/C27H27N3OS/c1-19-17-30(18-20(2)29-19)27-14-15-28-26-13-12-24(16-25(26)27)32-23-10-8-22(9-11-23)31-21-6-4-3-5-7-21/h3-16,19-20,29H,17-18H2,1-2H3/t19-,20+.
What are the key properties of 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline?
4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline has a molecular weight of 441.60 g/mol, XLogP of 6.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-(4-phenoxyphenyl)sulfanylquinoline is sourced from PubChem (CID 44529290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).